About actinium;1-phenylpiperazine
actinium;1-phenylpiperazine (PubChem CID 20683931) has the molecular formula C10H13AcN2-
and a molecular weight of 388.23 g/mol. Its IUPAC name is actinium;1-phenylpiperazine.
Molecular Properties
| Compound Name | actinium;1-phenylpiperazine |
| PubChem CID | 20683931 |
| Molecular Formula | C10H13AcN2- |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | actinium;1-phenylpiperazine |
| SMILES | [Ac].[c-]1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C10H13N2.Ac/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;/h2-5,11H,6-9H2;/q-1; |
| InChIKey | LMOGGDIQUQLRLL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze actinium;1-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;1-phenylpiperazine?
The IUPAC name of actinium;1-phenylpiperazine (CID 20683931) is actinium;1-phenylpiperazine.
What is the SMILES notation for actinium;1-phenylpiperazine?
The canonical SMILES for actinium;1-phenylpiperazine is [Ac].[c-]1ccc(N2CCNCC2)cc1.
What is the InChIKey of actinium;1-phenylpiperazine?
The InChIKey is LMOGGDIQUQLRLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N2.Ac/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;/h2-5,11H,6-9H2;/q-1;.
What are the key properties of actinium;1-phenylpiperazine?
actinium;1-phenylpiperazine has a molecular weight of 388.23 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;1-phenylpiperazine is sourced from PubChem (CID 20683931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).