About N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide
N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide (PubChem CID 20684092) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide.
Analyze N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide?
The IUPAC name of N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide (CID 20684092) is N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide.
What is the SMILES notation for N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide?
The canonical SMILES for N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide is CNC(=O)C1=C(C)NC(C)N1.
What is the InChIKey of N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide?
The InChIKey is PUXSQTMAUGFKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-4-6(7(11)8-3)10-5(2)9-4/h5,9-10H,1-3H3,(H,8,11).
What are the key properties of N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide?
N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide has a molecular weight of 155.20 g/mol, XLogP of -0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,5-trimethyl-2,3-dihydro-1H-imidazole-4-carboxamide is sourced from PubChem (CID 20684092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).