About ditert-butyl 2-ethylidenepropanedioate
ditert-butyl 2-ethylidenepropanedioate (PubChem CID 20684138) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is ditert-butyl 2-ethylidenepropanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-ethylidenepropanedioate |
| PubChem CID | 20684138 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | ditert-butyl 2-ethylidenepropanedioate |
| SMILES | CC=C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22O4/c1-8-9(10(14)16-12(2,3)4)11(15)17-13(5,6)7/h8H,1-7H3 |
| InChIKey | TYYRFKFPZJKPEU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-ethylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-ethylidenepropanedioate?
The IUPAC name of ditert-butyl 2-ethylidenepropanedioate (CID 20684138) is ditert-butyl 2-ethylidenepropanedioate.
What is the SMILES notation for ditert-butyl 2-ethylidenepropanedioate?
The canonical SMILES for ditert-butyl 2-ethylidenepropanedioate is CC=C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2-ethylidenepropanedioate?
The InChIKey is TYYRFKFPZJKPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-8-9(10(14)16-12(2,3)4)11(15)17-13(5,6)7/h8H,1-7H3.
What are the key properties of ditert-butyl 2-ethylidenepropanedioate?
ditert-butyl 2-ethylidenepropanedioate has a molecular weight of 242.31 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-ethylidenepropanedioate is sourced from PubChem (CID 20684138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).