C12H20N2O6 — CID 20684252
(1R,2S,3R)-1-[5-[(3S)-3,4-dihydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol (PubChem CID 20684252) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is (1R,2S,3R)-1-[5-[(3S)-3,4-dihydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3R)-1-[5-[(3S)-3,4-dihydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 20684252 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (1R,2S,3R)-1-[5-[(3S)-3,4-dihydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)CCc1cnc([C@@H](O)[C@H](O)[C@H](O)CO)cn1 |
| InChI | InChI=1S/C12H20N2O6/c15-5-8(17)2-1-7-3-14-9(4-13-7)11(19)12(20)10(18)6-16/h3-4,8,10-12,15-20H,1-2,5-6H2/t8-,10+,11+,12+/m0/s1 |
| InChIKey | IEFHMWITWCMRIK-JTLRNRKASA-N |
| XLogP | -2.49 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |