C18H32N2O7 — CID 20684292
(2S,3S,4S)-2,4-diethoxy-4-[5-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]pyrazin-2-yl]butane-1,3-diol (PubChem CID 20684292) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2S,3S,4S)-2,4-diethoxy-4-[5-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]pyrazin-2-yl]butane-1,3-diol.
| Compound Name | (2S,3S,4S)-2,4-diethoxy-4-[5-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]pyrazin-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 20684292 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (2S,3S,4S)-2,4-diethoxy-4-[5-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]pyrazin-2-yl]butane-1,3-diol |
| SMILES | CCO[C@@H](CO)[C@@H](O)[C@@H](OCC)c1cnc(C[C@H](O)[C@H](CO)OCC)cn1 |
| InChI | InChI=1S/C18H32N2O7/c1-4-25-15(10-21)14(23)7-12-8-20-13(9-19-12)18(27-6-3)17(24)16(11-22)26-5-2/h8-9,14-18,21-24H,4-7,10-11H2,1-3H3/t14-,15-,16-,17+,18-/m0/s1 |
| InChIKey | BJSPGRLALVKDAG-TXTZMMAHSA-N |
| XLogP | -0.39 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |