C12H19FN2O6 — CID 20684300
(1R,2S,3S)-4-fluoro-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl]pyrazin-2-yl]butane-1,2,3-triol (PubChem CID 20684300) has the molecular formula C12H19FN2O6 and a molecular weight of 306.29 g/mol. Its IUPAC name is (1R,2S,3S)-4-fluoro-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl]pyrazin-2-yl]butane-1,2,3-triol.
| Compound Name | (1R,2S,3S)-4-fluoro-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl]pyrazin-2-yl]butane-1,2,3-triol |
|---|---|
| PubChem CID | 20684300 |
| Molecular Formula | C12H19FN2O6 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (1R,2S,3S)-4-fluoro-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl]pyrazin-2-yl]butane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)Cc1cnc([C@@H](O)[C@H](O)[C@H](O)CF)cn1 |
| InChI | InChI=1S/C12H19FN2O6/c13-2-9(18)12(21)11(20)7-4-14-6(3-15-7)1-8(17)10(19)5-16/h3-4,8-12,16-21H,1-2,5H2/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | WVUJSSDRYKXVHT-VSSNEEPJSA-N |
| XLogP | -2.54 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |