C21H23F3N2O3 — CID 20684496
1-N,2-N-diethoxy-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propane-1,2-diimine (PubChem CID 20684496) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-N,2-N-diethoxy-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propane-1,2-diimine.
| Compound Name | 1-N,2-N-diethoxy-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propane-1,2-diimine |
|---|---|
| PubChem CID | 20684496 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-N,2-N-diethoxy-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propane-1,2-diimine |
| SMILES | CCO/N=C(C)/C(=N/OCC)c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H23F3N2O3/c1-4-28-25-15(3)20(26-29-5-2)17-9-11-19(12-10-17)27-14-16-7-6-8-18(13-16)21(22,23)24/h6-13H,4-5,14H2,1-3H3/b25-15+,26-20- |
| InChIKey | FEHAEEUUXZCQOB-PTQXYTRWSA-N |
| XLogP | 5.44 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|