About 2-methanidyl-2,3,3-trimethylbutane;ytterbium
2-methanidyl-2,3,3-trimethylbutane;ytterbium (PubChem CID 20686237) has the molecular formula C8H17Yb-
and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-methanidyl-2,3,3-trimethylbutane;ytterbium.
Molecular Properties
| Compound Name | 2-methanidyl-2,3,3-trimethylbutane;ytterbium |
| PubChem CID | 20686237 |
| Molecular Formula | C8H17Yb- |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-methanidyl-2,3,3-trimethylbutane;ytterbium |
| SMILES | [CH2-]C(C)(C)C(C)(C)C.[Yb] |
| InChI | InChI=1S/C8H17.Yb/c1-7(2,3)8(4,5)6;/h1H2,2-6H3;/q-1; |
| InChIKey | CZMHKDZHPVWOBP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidyl-2,3,3-trimethylbutane;ytterbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidyl-2,3,3-trimethylbutane;ytterbium?
The IUPAC name of 2-methanidyl-2,3,3-trimethylbutane;ytterbium (CID 20686237) is 2-methanidyl-2,3,3-trimethylbutane;ytterbium.
What is the SMILES notation for 2-methanidyl-2,3,3-trimethylbutane;ytterbium?
The canonical SMILES for 2-methanidyl-2,3,3-trimethylbutane;ytterbium is [CH2-]C(C)(C)C(C)(C)C.[Yb].
What is the InChIKey of 2-methanidyl-2,3,3-trimethylbutane;ytterbium?
The InChIKey is CZMHKDZHPVWOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.Yb/c1-7(2,3)8(4,5)6;/h1H2,2-6H3;/q-1;.
What are the key properties of 2-methanidyl-2,3,3-trimethylbutane;ytterbium?
2-methanidyl-2,3,3-trimethylbutane;ytterbium has a molecular weight of 286.26 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidyl-2,3,3-trimethylbutane;ytterbium is sourced from PubChem (CID 20686237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).