C19H8F5NO3 — CID 20686256
2-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[de]isoquinoline-1,3-dione (PubChem CID 20686256) has the molecular formula C19H8F5NO3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 20686256 |
| Molecular Formula | C19H8F5NO3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H8F5NO3/c20-13-11(14(21)16(23)17(24)15(13)22)7-28-25-18(26)9-5-1-3-8-4-2-6-10(12(8)9)19(25)27/h1-6H,7H2 |
| InChIKey | CDYCVBOTHGEBIR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|