C32H34ClN3O5 — CID 20686495
N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(2,4-dimethylphenoxy)butanoylamino]benzamide (PubChem CID 20686495) has the molecular formula C32H34ClN3O5 and a molecular weight of 576.09 g/mol. Its IUPAC name is N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(2,4-dimethylphenoxy)butanoylamino]benzamide.
| Compound Name | N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(2,4-dimethylphenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 20686495 |
| Molecular Formula | C32H34ClN3O5 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(2,4-dimethylphenoxy)butanoylamino]benzamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)Nc1cccc(C(=O)Nc2cc(Cl)c3c(c2O)C2(CCCCC2)C(=O)N3)c1 |
| InChI | InChI=1S/C32H34ClN3O5/c1-4-24(41-25-12-11-18(2)15-19(25)3)30(39)34-21-10-8-9-20(16-21)29(38)35-23-17-22(33)27-26(28(23)37)32(31(40)36-27)13-6-5-7-14-32/h8-12,15-17,24,37H,4-7,13-14H2,1-3H3,(H,34,39)(H,35,38)(H,36,40) |
| InChIKey | BTZDTVLHEJBGAU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|