C34H28Cl4N3O+ — CID 20686611
2-[(E)-3-[5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]benzimidazol-2-ylidene]prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium (PubChem CID 20686611) has the molecular formula C34H28Cl4N3O+ and a molecular weight of 636.43 g/mol. Its IUPAC name is 2-[(E)-3-[5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]benzimidazol-2-ylidene]prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium.
| Compound Name | 2-[(E)-3-[5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]benzimidazol-2-ylidene]prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 20686611 |
| Molecular Formula | C34H28Cl4N3O+ |
| Molecular Weight | 636.43 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | 2-[(E)-3-[5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]benzimidazol-2-ylidene]prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium |
| SMILES | C[n+]1c(/C=C/C=C2N(Cc3ccc(CCl)cc3)c3cc(Cl)c(Cl)cc3N2Cc2ccc(CCl)cc2)oc2ccccc21 |
| InChI | InChI=1S/C34H28Cl4N3O/c1-39-29-5-2-3-6-32(29)42-34(39)8-4-7-33-40(21-25-13-9-23(19-35)10-14-25)30-17-27(37)28(38)18-31(30)41(33)22-26-15-11-24(20-36)12-16-26/h2-18H,19-22H2,1H3/q+1 |
| InChIKey | GRSZUBMAIXOGKW-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 23.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.43 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|