C29H48O8 — CID 20686627
2-(1-acetyloxypropyl)-3-butoxycarbonyl-7-methyl-8-oxo-8-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid (PubChem CID 20686627) has the molecular formula C29H48O8 and a molecular weight of 524.70 g/mol. Its IUPAC name is 2-(1-acetyloxypropyl)-3-butoxycarbonyl-7-methyl-8-oxo-8-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid.
| Compound Name | 2-(1-acetyloxypropyl)-3-butoxycarbonyl-7-methyl-8-oxo-8-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid |
|---|---|
| PubChem CID | 20686627 |
| Molecular Formula | C29H48O8 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 2-(1-acetyloxypropyl)-3-butoxycarbonyl-7-methyl-8-oxo-8-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid |
| SMILES | CCCCOC(=O)C(CCCC(C)C(=O)OC1CC2CCC1(C)C2(C)C)C(C(=O)O)C(CC)OC(C)=O |
| InChI | InChI=1S/C29H48O8/c1-8-10-16-35-27(34)21(24(25(31)32)22(9-2)36-19(4)30)13-11-12-18(3)26(33)37-23-17-20-14-15-29(23,7)28(20,5)6/h18,20-24H,8-17H2,1-7H3,(H,31,32) |
| InChIKey | VLKAYBPPCBJSKW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|