About 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate
3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 20686763) has the molecular formula C6H7O5-
and a molecular weight of 159.12 g/mol. Its IUPAC name is 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate.
Molecular Properties
| Compound Name | 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
| PubChem CID | 20686763 |
| Molecular Formula | C6H7O5- |
| Molecular Weight | 159.12 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | O=C([O-])C1=CC(O)C(O)CO1 |
| InChI | InChI=1S/C6H8O5/c7-3-1-5(6(9)10)11-2-4(3)8/h1,3-4,7-8H,2H2,(H,9,10)/p-1 |
| InChIKey | GQECVRZDTXJRPX-UHFFFAOYSA-M |
| XLogP | -2.63 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.12 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
The IUPAC name of 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (CID 20686763) is 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate.
What is the SMILES notation for 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
The canonical SMILES for 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate is O=C([O-])C1=CC(O)C(O)CO1.
What is the InChIKey of 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
The InChIKey is GQECVRZDTXJRPX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O5/c7-3-1-5(6(9)10)11-2-4(3)8/h1,3-4,7-8H,2H2,(H,9,10)/p-1.
What are the key properties of 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate has a molecular weight of 159.12 g/mol, XLogP of -2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate is sourced from PubChem (CID 20686763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).