C6H7O5- — CID 20686763
3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 20686763) has the molecular formula C6H7O5- and a molecular weight of 159.12 g/mol. Its IUPAC name is 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 20686763 |
| Molecular Formula | C6H7O5- |
| Molecular Weight | 159.12 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | 3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | O=C([O-])C1=CC(O)C(O)CO1 |
| InChI | InChI=1S/C6H8O5/c7-3-1-5(6(9)10)11-2-4(3)8/h1,3-4,7-8H,2H2,(H,9,10)/p-1 |
| InChIKey | GQECVRZDTXJRPX-UHFFFAOYSA-M |
| XLogP | -2.63 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.12 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |