About CID 20686844
CID 20686844 (PubChem CID 20686844) has the molecular formula H4N2O2S
and a molecular weight of 96.11 g/mol.
Molecular Properties
| Compound Name | CID 20686844 |
| PubChem CID | 20686844 |
| Molecular Formula | H4N2O2S |
| Molecular Weight | 96.11 g/mol |
| Exact Mass | 96.00 |
| IUPAC Name | — |
| SMILES | NOS(N)=O |
| InChI | InChI=1S/H4N2O2S/c1-4-5(2)3/h1-2H2 |
| InChIKey | NQHHKNZJMSIETN-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.11 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 20686844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20686844?
The IUPAC name of CID 20686844 (CID 20686844) is not available.
What is the SMILES notation for CID 20686844?
The canonical SMILES for CID 20686844 is NOS(N)=O.
What is the InChIKey of CID 20686844?
The InChIKey is NQHHKNZJMSIETN-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N2O2S/c1-4-5(2)3/h1-2H2.
What are the key properties of CID 20686844?
CID 20686844 has a molecular weight of 96.11 g/mol, XLogP of -1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20686844 is sourced from PubChem (CID 20686844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).