C16H22N4O2 — CID 20686993
4-[8-(2-hydroxyethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide (PubChem CID 20686993) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[8-(2-hydroxyethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide.
| Compound Name | 4-[8-(2-hydroxyethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 20686993 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[8-(2-hydroxyethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC3(CCN(CCO)CC3)C2)cc1 |
| InChI | InChI=1S/C16H22N4O2/c17-15(18)13-3-1-12(2-4-13)14-11-16(22-19-14)5-7-20(8-6-16)9-10-21/h1-4,21H,5-11H2,(H3,17,18) |
| InChIKey | JJMMPHOFRTVNBT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|