C15H33N — CID 20687221
3,5,5-trimethyl-N,N-di(propan-2-yl)hexan-1-amine (PubChem CID 20687221) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 3,5,5-trimethyl-N,N-di(propan-2-yl)hexan-1-amine.
| Compound Name | 3,5,5-trimethyl-N,N-di(propan-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 20687221 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 3,5,5-trimethyl-N,N-di(propan-2-yl)hexan-1-amine |
| SMILES | CC(CCN(C(C)C)C(C)C)CC(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-12(2)16(13(3)4)10-9-14(5)11-15(6,7)8/h12-14H,9-11H2,1-8H3 |
| InChIKey | QWGCMRYMOWQLKT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |