C13H15F2N2O4P — CID 20687305
3-(diethoxyphosphorylmethyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole (PubChem CID 20687305) has the molecular formula C13H15F2N2O4P and a molecular weight of 332.24 g/mol. Its IUPAC name is 3-(diethoxyphosphorylmethyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(diethoxyphosphorylmethyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 20687305 |
| Molecular Formula | C13H15F2N2O4P |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-(diethoxyphosphorylmethyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole |
| SMILES | CCOP(=O)(Cc1noc(-c2c(F)cccc2F)n1)OCC |
| InChI | InChI=1S/C13H15F2N2O4P/c1-3-19-22(18,20-4-2)8-11-16-13(21-17-11)12-9(14)6-5-7-10(12)15/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | BGFYNASUDQXUOF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|