C34H33N5O2S — CID 2068740
2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide (PubChem CID 2068740) has the molecular formula C34H33N5O2S and a molecular weight of 575.74 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2068740 |
| Molecular Formula | C34H33N5O2S |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)NN=Cc3cccc(Oc4ccccc4)c3)nnc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H33N5O2S/c1-24-13-19-28(20-14-24)39-32(26-15-17-27(18-16-26)34(2,3)4)37-38-33(39)42-23-31(40)36-35-22-25-9-8-12-30(21-25)41-29-10-6-5-7-11-29/h5-22H,23H2,1-4H3,(H,36,40) |
| InChIKey | LWXNLNXICBTMCK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|