C27H24Cl2N2O6S — CID 20687432
(2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoic acid (PubChem CID 20687432) has the molecular formula C27H24Cl2N2O6S and a molecular weight of 575.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 20687432 |
| Molecular Formula | C27H24Cl2N2O6S |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoic acid |
| SMILES | O=Cc1ccccc1-c1ccc(C[C@H](NC(=O)[C@@H]2CCCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H24Cl2N2O6S/c28-20-13-21(29)15-22(14-20)38(36,37)31-11-3-6-25(31)26(33)30-24(27(34)35)12-17-7-9-18(10-8-17)23-5-2-1-4-19(23)16-32/h1-2,4-5,7-10,13-16,24-25H,3,6,11-12H2,(H,30,33)(H,34,35)/t24-,25-/m0/s1 |
| InChIKey | MMYBBVWYPAIKBK-DQEYMECFSA-N |
| XLogP | 4.44 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|