C24H38F5N3O5 — CID 20687776
2-[3-(3,3-dimethylbutanoylamino)-4,4-dimethyl-2-oxopentyl]-N',N'-dimethyl-N-(4,4,5,5,5-pentafluoro-3-oxopentan-2-yl)butanediamide (PubChem CID 20687776) has the molecular formula C24H38F5N3O5 and a molecular weight of 543.57 g/mol. Its IUPAC name is 2-[3-(3,3-dimethylbutanoylamino)-4,4-dimethyl-2-oxopentyl]-N',N'-dimethyl-N-(4,4,5,5,5-pentafluoro-3-oxopentan-2-yl)butanediamide.
| Compound Name | 2-[3-(3,3-dimethylbutanoylamino)-4,4-dimethyl-2-oxopentyl]-N',N'-dimethyl-N-(4,4,5,5,5-pentafluoro-3-oxopentan-2-yl)butanediamide |
|---|---|
| PubChem CID | 20687776 |
| Molecular Formula | C24H38F5N3O5 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 2-[3-(3,3-dimethylbutanoylamino)-4,4-dimethyl-2-oxopentyl]-N',N'-dimethyl-N-(4,4,5,5,5-pentafluoro-3-oxopentan-2-yl)butanediamide |
| SMILES | CC(NC(=O)C(CC(=O)C(NC(=O)CC(C)(C)C)C(C)(C)C)CC(=O)N(C)C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H38F5N3O5/c1-13(19(36)23(25,26)24(27,28)29)30-20(37)14(11-17(35)32(8)9)10-15(33)18(22(5,6)7)31-16(34)12-21(2,3)4/h13-14,18H,10-12H2,1-9H3,(H,30,37)(H,31,34) |
| InChIKey | ASUCDECMEITKAN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|