About N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide
N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide (PubChem CID 20687781) has the molecular formula C15H29N3O3
and a molecular weight of 299.42 g/mol. Its IUPAC name is N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide.
Molecular Properties
| Compound Name | N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide |
| PubChem CID | 20687781 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide |
| SMILES | CCNC(CC(=O)N(C)C(C)(C)C)C(=O)NC(C)C(C)=O |
| InChI | InChI=1S/C15H29N3O3/c1-8-16-12(14(21)17-10(2)11(3)19)9-13(20)18(7)15(4,5)6/h10,12,16H,8-9H2,1-7H3,(H,17,21) |
| InChIKey | DIJDEZLPLHTNII-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide?
The IUPAC name of N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide (CID 20687781) is N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide.
What is the SMILES notation for N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide?
The canonical SMILES for N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide is CCNC(CC(=O)N(C)C(C)(C)C)C(=O)NC(C)C(C)=O.
What is the InChIKey of N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide?
The InChIKey is DIJDEZLPLHTNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O3/c1-8-16-12(14(21)17-10(2)11(3)19)9-13(20)18(7)15(4,5)6/h10,12,16H,8-9H2,1-7H3,(H,17,21).
What are the key properties of N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide?
N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide has a molecular weight of 299.42 g/mol, XLogP of 0.71, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-2-(ethylamino)-N'-methyl-N-(3-oxobutan-2-yl)butanediamide is sourced from PubChem (CID 20687781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).