About americium;N'-methanidyloxy-N,N-dimethylethanimidamide
americium;N'-methanidyloxy-N,N-dimethylethanimidamide (PubChem CID 20687841) has the molecular formula C5H11AmN2O-
and a molecular weight of 358.16 g/mol. Its IUPAC name is americium;N'-methanidyloxy-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | americium;N'-methanidyloxy-N,N-dimethylethanimidamide |
| PubChem CID | 20687841 |
| Molecular Formula | C5H11AmN2O- |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | americium;N'-methanidyloxy-N,N-dimethylethanimidamide |
| SMILES | [Am].[CH2-]O/N=C(/C)N(C)C |
| InChI | InChI=1S/C5H11N2O.Am/c1-5(6-8-4)7(2)3;/h4H2,1-3H3;/q-1;/b6-5-; |
| InChIKey | VPBBWVDLOGXFGQ-YSMBQZINSA-N |
| XLogP | 0.69 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze americium;N'-methanidyloxy-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of americium;N'-methanidyloxy-N,N-dimethylethanimidamide?
The IUPAC name of americium;N'-methanidyloxy-N,N-dimethylethanimidamide (CID 20687841) is americium;N'-methanidyloxy-N,N-dimethylethanimidamide.
What is the SMILES notation for americium;N'-methanidyloxy-N,N-dimethylethanimidamide?
The canonical SMILES for americium;N'-methanidyloxy-N,N-dimethylethanimidamide is [Am].[CH2-]O/N=C(/C)N(C)C.
What is the InChIKey of americium;N'-methanidyloxy-N,N-dimethylethanimidamide?
The InChIKey is VPBBWVDLOGXFGQ-YSMBQZINSA-N. The full InChI is InChI=1S/C5H11N2O.Am/c1-5(6-8-4)7(2)3;/h4H2,1-3H3;/q-1;/b6-5-;.
What are the key properties of americium;N'-methanidyloxy-N,N-dimethylethanimidamide?
americium;N'-methanidyloxy-N,N-dimethylethanimidamide has a molecular weight of 358.16 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for americium;N'-methanidyloxy-N,N-dimethylethanimidamide is sourced from PubChem (CID 20687841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).