C23H33N5O4S2 — CID 20687894
N-[[(4S)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]amino]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]methanimidamide (PubChem CID 20687894) has the molecular formula C23H33N5O4S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[[(4S)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]amino]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]methanimidamide.
| Compound Name | N-[[(4S)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]amino]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]methanimidamide |
|---|---|
| PubChem CID | 20687894 |
| Molecular Formula | C23H33N5O4S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-[[(4S)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]amino]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]methanimidamide |
| SMILES | Cc1c(C)c(S(=O)(=O)/N=C/NNCCC[C@H](N)C(=O)c2nccs2)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C23H33N5O4S2/c1-14-15(2)21(16(3)17-8-9-23(4,5)32-20(14)17)34(30,31)28-13-27-26-10-6-7-18(24)19(29)22-25-11-12-33-22/h11-13,18,26H,6-10,24H2,1-5H3,(H,27,28)/t18-/m0/s1 |
| InChIKey | LAOAXONHIWPXEC-SFHVURJKSA-N |
| XLogP | 2.97 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|