About 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol
3-tert-butyl-2,2-dimethylnon-5-yn-3-ol (PubChem CID 20688053) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol |
| PubChem CID | 20688053 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol |
| SMILES | CCCC#CCC(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28O/c1-8-9-10-11-12-15(16,13(2,3)4)14(5,6)7/h16H,8-9,12H2,1-7H3 |
| InChIKey | BKUKVRKVNVJZGN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol?
The IUPAC name of 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol (CID 20688053) is 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol.
What is the SMILES notation for 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol?
The canonical SMILES for 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol is CCCC#CCC(O)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol?
The InChIKey is BKUKVRKVNVJZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-8-9-10-11-12-15(16,13(2,3)4)14(5,6)7/h16H,8-9,12H2,1-7H3.
What are the key properties of 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol?
3-tert-butyl-2,2-dimethylnon-5-yn-3-ol has a molecular weight of 224.39 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,2-dimethylnon-5-yn-3-ol is sourced from PubChem (CID 20688053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).