C41H58O4P2 — CID 20688088
(3,6-ditert-butylnaphthalen-2-yl)oxy-[4-(3,6-ditert-butylnaphthalen-2-yl)oxyphosphanyloxypentan-2-yloxy]phosphane (PubChem CID 20688088) has the molecular formula C41H58O4P2 and a molecular weight of 676.86 g/mol. Its IUPAC name is (3,6-ditert-butylnaphthalen-2-yl)oxy-[4-(3,6-ditert-butylnaphthalen-2-yl)oxyphosphanyloxypentan-2-yloxy]phosphane.
| Compound Name | (3,6-ditert-butylnaphthalen-2-yl)oxy-[4-(3,6-ditert-butylnaphthalen-2-yl)oxyphosphanyloxypentan-2-yloxy]phosphane |
|---|---|
| PubChem CID | 20688088 |
| Molecular Formula | C41H58O4P2 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | (3,6-ditert-butylnaphthalen-2-yl)oxy-[4-(3,6-ditert-butylnaphthalen-2-yl)oxyphosphanyloxypentan-2-yloxy]phosphane |
| SMILES | CC(CC(C)OPOc1cc2ccc(C(C)(C)C)cc2cc1C(C)(C)C)OPOc1cc2ccc(C(C)(C)C)cc2cc1C(C)(C)C |
| InChI | InChI=1S/C41H58O4P2/c1-26(42-46-44-36-24-28-15-17-32(38(3,4)5)20-30(28)22-34(36)40(9,10)11)19-27(2)43-47-45-37-25-29-16-18-33(39(6,7)8)21-31(29)23-35(37)41(12,13)14/h15-18,20-27,46-47H,19H2,1-14H3 |
| InChIKey | RVOPRMJMIIUBMM-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|