C11H22N3O+ — CID 20688130
9-(2-methoxyethyl)-1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium (PubChem CID 20688130) has the molecular formula C11H22N3O+ and a molecular weight of 212.32 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium.
| Compound Name | 9-(2-methoxyethyl)-1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium |
|---|---|
| PubChem CID | 20688130 |
| Molecular Formula | C11H22N3O+ |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 9-(2-methoxyethyl)-1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium |
| SMILES | COCCN1CCCN2CCC[N+](C)=C21 |
| InChI | InChI=1S/C11H22N3O/c1-12-5-3-6-13-7-4-8-14(11(12)13)9-10-15-2/h3-10H2,1-2H3/q+1 |
| InChIKey | ICJWTLKXGDDONZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|