About 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc
2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc (PubChem CID 20688269) has the molecular formula C22H21N3O2Zn
and a molecular weight of 424.82 g/mol. Its IUPAC name is 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc.
Molecular Properties
| Compound Name | 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc |
| PubChem CID | 20688269 |
| Molecular Formula | C22H21N3O2Zn |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc |
| SMILES | CCCCN(c1ccc2cccc(O)c2n1)c1ccc2cccc(O)c2n1.[Zn] |
| InChI | InChI=1S/C22H21N3O2.Zn/c1-2-3-14-25(19-12-10-15-6-4-8-17(26)21(15)23-19)20-13-11-16-7-5-9-18(27)22(16)24-20;/h4-13,26-27H,2-3,14H2,1H3; |
| InChIKey | FWYFOZMHEDGKII-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc?
The IUPAC name of 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc (CID 20688269) is 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc.
What is the SMILES notation for 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc?
The canonical SMILES for 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc is CCCCN(c1ccc2cccc(O)c2n1)c1ccc2cccc(O)c2n1.[Zn].
What is the InChIKey of 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc?
The InChIKey is FWYFOZMHEDGKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2.Zn/c1-2-3-14-25(19-12-10-15-6-4-8-17(26)21(15)23-19)20-13-11-16-7-5-9-18(27)22(16)24-20;/h4-13,26-27H,2-3,14H2,1H3;.
What are the key properties of 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc?
2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc has a molecular weight of 424.82 g/mol, XLogP of 5.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl-(8-hydroxyquinolin-2-yl)amino]quinolin-8-ol;zinc is sourced from PubChem (CID 20688269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).