About [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate
[2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate (PubChem CID 20688442) has the molecular formula C9H11BrO6S2
and a molecular weight of 359.22 g/mol. Its IUPAC name is [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate.
Molecular Properties
| Compound Name | [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate |
| PubChem CID | 20688442 |
| Molecular Formula | C9H11BrO6S2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate |
| SMILES | Cc1cc(SOOO)ccc1OS(=O)(=O)CCBr |
| InChI | InChI=1S/C9H11BrO6S2/c1-7-6-8(17-16-15-11)2-3-9(7)14-18(12,13)5-4-10/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | FPRYLGABTUFSOA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate?
The IUPAC name of [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate (CID 20688442) is [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate.
What is the SMILES notation for [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate?
The canonical SMILES for [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate is Cc1cc(SOOO)ccc1OS(=O)(=O)CCBr.
What is the InChIKey of [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate?
The InChIKey is FPRYLGABTUFSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO6S2/c1-7-6-8(17-16-15-11)2-3-9(7)14-18(12,13)5-4-10/h2-3,6,11H,4-5H2,1H3.
What are the key properties of [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate?
[2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate has a molecular weight of 359.22 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-4-(trioxidanylsulfanyl)phenyl] 2-bromoethanesulfonate is sourced from PubChem (CID 20688442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).