About sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide
sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide (PubChem CID 20688453) has the molecular formula C11H13BrNNaO3S2
and a molecular weight of 374.26 g/mol. Its IUPAC name is sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide.
Molecular Properties
| Compound Name | sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide |
| PubChem CID | 20688453 |
| Molecular Formula | C11H13BrNNaO3S2 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide |
| SMILES | Cc1cc(C(=S)NCCBr)c(C)cc1SOO[O-].[Na+] |
| InChI | InChI=1S/C11H14BrNO3S2.Na/c1-7-6-10(18-16-15-14)8(2)5-9(7)11(17)13-4-3-12;/h5-6,14H,3-4H2,1-2H3,(H,13,17);/q;+1/p-1 |
| InChIKey | BVEIAVALOCQQNV-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 53.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide?
The IUPAC name of sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide (CID 20688453) is sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide.
What is the SMILES notation for sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide?
The canonical SMILES for sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide is Cc1cc(C(=S)NCCBr)c(C)cc1SOO[O-].[Na+].
What is the InChIKey of sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide?
The InChIKey is BVEIAVALOCQQNV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14BrNO3S2.Na/c1-7-6-10(18-16-15-14)8(2)5-9(7)11(17)13-4-3-12;/h5-6,14H,3-4H2,1-2H3,(H,13,17);/q;+1/p-1.
What are the key properties of sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide?
sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide has a molecular weight of 374.26 g/mol, XLogP of -0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-(2-bromoethyl)-2,5-dimethyl-4-oxidoperoxysulfanylbenzenecarbothioamide is sourced from PubChem (CID 20688453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).