About 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide
3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide (PubChem CID 20688547) has the molecular formula C11H14BrNO4S
and a molecular weight of 336.21 g/mol. Its IUPAC name is 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide |
| PubChem CID | 20688547 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide |
| SMILES | Cc1cc(SOOO)cc(C)c1NC(=O)CCBr |
| InChI | InChI=1S/C11H14BrNO4S/c1-7-5-9(18-17-16-15)6-8(2)11(7)13-10(14)3-4-12/h5-6,15H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | NPHBKASQSNAILO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide?
The IUPAC name of 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide (CID 20688547) is 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide.
What is the SMILES notation for 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide?
The canonical SMILES for 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide is Cc1cc(SOOO)cc(C)c1NC(=O)CCBr.
What is the InChIKey of 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide?
The InChIKey is NPHBKASQSNAILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO4S/c1-7-5-9(18-17-16-15)6-8(2)11(7)13-10(14)3-4-12/h5-6,15H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide?
3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide has a molecular weight of 336.21 g/mol, XLogP of 3.46, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[2,6-dimethyl-4-(trioxidanylsulfanyl)phenyl]propanamide is sourced from PubChem (CID 20688547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).