About disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate
disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate (PubChem CID 20688687) has the molecular formula C9H9BrN2Na2O8S2
and a molecular weight of 463.20 g/mol. Its IUPAC name is disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate.
Molecular Properties
| Compound Name | disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate |
| PubChem CID | 20688687 |
| Molecular Formula | C9H9BrN2Na2O8S2 |
| Molecular Weight | 463.20 g/mol |
| Exact Mass | 461.88 |
| IUPAC Name | disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate |
| SMILES | CCc1nc(SOO[O-])c(SOO[O-])nc1OC(=O)CCBr.[Na+].[Na+] |
| InChI | InChI=1S/C9H11BrN2O8S2.2Na/c1-2-5-7(16-6(13)3-4-10)12-9(22-20-18-15)8(11-5)21-19-17-14;;/h14-15H,2-4H2,1H3;;/q;2*+1/p-2 |
| InChIKey | IXRGOKZVXDWKBK-UHFFFAOYSA-L |
| XLogP | -5.80 |
| TPSA | 135.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.20 |
| LogP ≤ 5 | -5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate?
The IUPAC name of disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate (CID 20688687) is disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate.
What is the SMILES notation for disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate?
The canonical SMILES for disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate is CCc1nc(SOO[O-])c(SOO[O-])nc1OC(=O)CCBr.[Na+].[Na+].
What is the InChIKey of disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate?
The InChIKey is IXRGOKZVXDWKBK-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H11BrN2O8S2.2Na/c1-2-5-7(16-6(13)3-4-10)12-9(22-20-18-15)8(11-5)21-19-17-14;;/h14-15H,2-4H2,1H3;;/q;2*+1/p-2.
What are the key properties of disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate?
disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate has a molecular weight of 463.20 g/mol, XLogP of -5.80, 10 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[3-ethyl-5,6-bis(oxidoperoxysulfanyl)pyrazin-2-yl] 3-bromopropanoate is sourced from PubChem (CID 20688687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).