About N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide
N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide (PubChem CID 20689085) has the molecular formula C12H29N5O+2
and a molecular weight of 259.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide |
| PubChem CID | 20689085 |
| Molecular Formula | C12H29N5O+2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.24 |
| IUPAC Name | N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide |
| SMILES | CC(C)[N+]1(C)CC[N+](N)(CC(=O)NCCN)CC1 |
| InChI | InChI=1S/C12H28N5O/c1-11(2)16(3)6-8-17(14,9-7-16)10-12(18)15-5-4-13/h11H,4-10,13-14H2,1-3H3/q+1/p+1 |
| InChIKey | DFDJQYJMWBZMOF-UHFFFAOYSA-O |
| XLogP | -1.38 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide?
The IUPAC name of N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide (CID 20689085) is N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide.
What is the SMILES notation for N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide?
The canonical SMILES for N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide is CC(C)[N+]1(C)CC[N+](N)(CC(=O)NCCN)CC1.
What is the InChIKey of N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide?
The InChIKey is DFDJQYJMWBZMOF-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H28N5O/c1-11(2)16(3)6-8-17(14,9-7-16)10-12(18)15-5-4-13/h11H,4-10,13-14H2,1-3H3/q+1/p+1.
What are the key properties of N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide?
N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide has a molecular weight of 259.40 g/mol, XLogP of -1.38, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2-(1-amino-4-methyl-4-propan-2-ylpiperazine-1,4-diium-1-yl)acetamide is sourced from PubChem (CID 20689085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).