About 4-methoxy-2,3-dimethylbenzenesulfonyl chloride
4-methoxy-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 20689151) has the molecular formula C9H11ClO3S
and a molecular weight of 234.70 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-methoxy-2,3-dimethylbenzenesulfonyl chloride |
| PubChem CID | 20689151 |
| Molecular Formula | C9H11ClO3S |
| Molecular Weight | 234.70 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 4-methoxy-2,3-dimethylbenzenesulfonyl chloride |
| SMILES | COc1ccc(S(=O)(=O)Cl)c(C)c1C |
| InChI | InChI=1S/C9H11ClO3S/c1-6-7(2)9(14(10,11)12)5-4-8(6)13-3/h4-5H,1-3H3 |
| InChIKey | WYOJSJPQGYIIIR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,3-dimethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
The IUPAC name of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride (CID 20689151) is 4-methoxy-2,3-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 4-methoxy-2,3-dimethylbenzenesulfonyl chloride is COc1ccc(S(=O)(=O)Cl)c(C)c1C.
What is the InChIKey of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
The InChIKey is WYOJSJPQGYIIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO3S/c1-6-7(2)9(14(10,11)12)5-4-8(6)13-3/h4-5H,1-3H3.
What are the key properties of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
4-methoxy-2,3-dimethylbenzenesulfonyl chloride has a molecular weight of 234.70 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 20689151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).