4-methoxy-2,3-dimethylbenzenesulfonyl chloride

C9H11ClO3S — CID 20689151

IUPAC4-methoxy-2,3-dimethylbenzenesulfonyl chloride
SMILESCOc1ccc(S(=O)(=O)Cl)c(C)c1C
InChIInChI=1S/C9H11ClO3S/c1-6-7(2)9(14(10,11)12)5-4-8(6)13-3/h4-5H,1-3H3
InChIKeyWYOJSJPQGYIIIR-UHFFFAOYSA-N
MW234.70 g/mol
LogP2.24
Rot. Bonds2

About 4-methoxy-2,3-dimethylbenzenesulfonyl chloride

4-methoxy-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 20689151) has the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethylbenzenesulfonyl chloride.

Molecular Properties

Compound Name4-methoxy-2,3-dimethylbenzenesulfonyl chloride
PubChem CID20689151
Molecular FormulaC9H11ClO3S
Molecular Weight234.70 g/mol
Exact Mass234.01
IUPAC Name4-methoxy-2,3-dimethylbenzenesulfonyl chloride
SMILESCOc1ccc(S(=O)(=O)Cl)c(C)c1C
InChIInChI=1S/C9H11ClO3S/c1-6-7(2)9(14(10,11)12)5-4-8(6)13-3/h4-5H,1-3H3
InChIKeyWYOJSJPQGYIIIR-UHFFFAOYSA-N
XLogP2.24
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.70
LogP ≤ 52.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-methoxy-2,3-dimethylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
The IUPAC name of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride (CID 20689151) is 4-methoxy-2,3-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 4-methoxy-2,3-dimethylbenzenesulfonyl chloride is COc1ccc(S(=O)(=O)Cl)c(C)c1C.
What is the InChIKey of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
The InChIKey is WYOJSJPQGYIIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO3S/c1-6-7(2)9(14(10,11)12)5-4-8(6)13-3/h4-5H,1-3H3.
What are the key properties of 4-methoxy-2,3-dimethylbenzenesulfonyl chloride?
4-methoxy-2,3-dimethylbenzenesulfonyl chloride has a molecular weight of 234.70 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 20689151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).