C19H26O8S — CID 20689669
(4-methylphenyl)sulfonyl-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol (PubChem CID 20689669) has the molecular formula C19H26O8S and a molecular weight of 414.48 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol.
| Compound Name | (4-methylphenyl)sulfonyl-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol |
|---|---|
| PubChem CID | 20689669 |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (4-methylphenyl)sulfonyl-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)C(O)[C@@H]2OC(C)(C)O[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]32)cc1 |
| InChI | InChI=1S/C19H26O8S/c1-10-6-8-11(9-7-10)28(21,22)16(20)14-12-13(24-18(2,3)25-14)15-17(23-12)27-19(4,5)26-15/h6-9,12-17,20H,1-5H3/t12-,13-,14+,15+,16?,17+/m0/s1 |
| InChIKey | KRSGWKYROAIDNK-CZKRYKJPSA-N |
| XLogP | 1.48 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |