About methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane
methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane (PubChem CID 20689823) has the molecular formula C20H21B
and a molecular weight of 272.20 g/mol. Its IUPAC name is methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane.
Molecular Properties
| Compound Name | methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane |
| PubChem CID | 20689823 |
| Molecular Formula | C20H21B |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane |
| SMILES | CB(c1c(C)cc(C)cc1C)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H21B/c1-14-12-15(2)20(16(3)13-14)21(4)19-11-7-9-17-8-5-6-10-18(17)19/h5-13H,1-4H3 |
| InChIKey | QTLCMYQZBMBTCY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane?
The IUPAC name of methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane (CID 20689823) is methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane.
What is the SMILES notation for methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane?
The canonical SMILES for methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane is CB(c1c(C)cc(C)cc1C)c1cccc2ccccc12.
What is the InChIKey of methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane?
The InChIKey is QTLCMYQZBMBTCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21B/c1-14-12-15(2)20(16(3)13-14)21(4)19-11-7-9-17-8-5-6-10-18(17)19/h5-13H,1-4H3.
What are the key properties of methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane?
methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane has a molecular weight of 272.20 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-naphthalen-1-yl-(2,4,6-trimethylphenyl)borane is sourced from PubChem (CID 20689823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).