C18H14N2O8S2 — CID 20689905
6-methyl-2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4-sulfonic acid (PubChem CID 20689905) has the molecular formula C18H14N2O8S2 and a molecular weight of 450.45 g/mol. Its IUPAC name is 6-methyl-2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4-sulfonic acid.
| Compound Name | 6-methyl-2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4-sulfonic acid |
|---|---|
| PubChem CID | 20689905 |
| Molecular Formula | C18H14N2O8S2 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 6-methyl-2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2nc(/C=C/c3nc4c(S(=O)(=O)O)cc(C)cc4o3)oc2c1 |
| InChI | InChI=1S/C18H14N2O8S2/c1-9-5-11-17(13(7-9)29(21,22)23)19-15(27-11)3-4-16-20-18-12(28-16)6-10(2)8-14(18)30(24,25)26/h3-8H,1-2H3,(H,21,22,23)(H,24,25,26)/b4-3+ |
| InChIKey | AWBUBYQNAMLALI-ONEGZZNKSA-N |
| XLogP | 3.25 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|