C26H26Cl6O8 — CID 20690175
2-O-(3,4,6-trichloro-2-pentoxycarbonylphenyl) 1-O-[3,4,6-trichloro-2-(pentylperoxymethyl)phenyl] oxalate (PubChem CID 20690175) has the molecular formula C26H26Cl6O8 and a molecular weight of 679.20 g/mol. Its IUPAC name is 2-O-(3,4,6-trichloro-2-pentoxycarbonylphenyl) 1-O-[3,4,6-trichloro-2-(pentylperoxymethyl)phenyl] oxalate.
| Compound Name | 2-O-(3,4,6-trichloro-2-pentoxycarbonylphenyl) 1-O-[3,4,6-trichloro-2-(pentylperoxymethyl)phenyl] oxalate |
|---|---|
| PubChem CID | 20690175 |
| Molecular Formula | C26H26Cl6O8 |
| Molecular Weight | 679.20 g/mol |
| Exact Mass | 675.98 |
| IUPAC Name | 2-O-(3,4,6-trichloro-2-pentoxycarbonylphenyl) 1-O-[3,4,6-trichloro-2-(pentylperoxymethyl)phenyl] oxalate |
| SMILES | CCCCCOOCc1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCCCCC |
| InChI | InChI=1S/C26H26Cl6O8/c1-3-5-7-9-36-24(33)19-21(32)16(28)12-18(30)23(19)40-26(35)25(34)39-22-14(13-38-37-10-8-6-4-2)20(31)15(27)11-17(22)29/h11-12H,3-10,13H2,1-2H3 |
| InChIKey | BHAAVTGAULQWOO-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.20 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|