C15H21BN2O4S — CID 20690372
CID 20690372 (PubChem CID 20690372) has the molecular formula C15H21BN2O4S and a molecular weight of 336.22 g/mol.
| Compound Name | CID 20690372 |
|---|---|
| PubChem CID | 20690372 |
| Molecular Formula | C15H21BN2O4S |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | — |
| SMILES | [B]C1CC(SC2=C(C(=O)O)N3C(=O)C(C(C)O)C3C2C)CN1C |
| InChI | InChI=1S/C15H21BN2O4S/c1-6-11-10(7(2)19)14(20)18(11)12(15(21)22)13(6)23-8-4-9(16)17(3)5-8/h6-11,19H,4-5H2,1-3H3,(H,21,22) |
| InChIKey | UVQYJCXYHCCODX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|