C17H23F3N6O4S — CID 20690396
(1S,2R,3S,4R)-4-[7-(butylamino)-5-(3,3,3-trifluoropropylsulfanyl)triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentane-1-carboxylic acid (PubChem CID 20690396) has the molecular formula C17H23F3N6O4S and a molecular weight of 464.47 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[7-(butylamino)-5-(3,3,3-trifluoropropylsulfanyl)triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1S,2R,3S,4R)-4-[7-(butylamino)-5-(3,3,3-trifluoropropylsulfanyl)triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 20690396 |
| Molecular Formula | C17H23F3N6O4S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (1S,2R,3S,4R)-4-[7-(butylamino)-5-(3,3,3-trifluoropropylsulfanyl)triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentane-1-carboxylic acid |
| SMILES | CCCCNc1nc(SCCC(F)(F)F)nc2c1nnn2[C@@H]1C[C@H](C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23F3N6O4S/c1-2-3-5-21-13-10-14(23-16(22-13)31-6-4-17(18,19)20)26(25-24-10)9-7-8(15(29)30)11(27)12(9)28/h8-9,11-12,27-28H,2-7H2,1H3,(H,29,30)(H,21,22,23)/t8-,9+,11+,12-/m0/s1 |
| InChIKey | VHNXRFBNYRYHNH-SPFNVWMYSA-N |
| XLogP | 1.85 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|