C21H34N8O4S — CID 20690412
(1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxy-N-[3-(methylamino)-3-oxopropyl]cyclopentane-1-carboxamide (PubChem CID 20690412) has the molecular formula C21H34N8O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxy-N-[3-(methylamino)-3-oxopropyl]cyclopentane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxy-N-[3-(methylamino)-3-oxopropyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 20690412 |
| Molecular Formula | C21H34N8O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxy-N-[3-(methylamino)-3-oxopropyl]cyclopentane-1-carboxamide |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2[C@@H]1C[C@H](C(=O)NCCC(=O)NC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H34N8O4S/c1-4-6-8-23-18-15-19(26-21(25-18)34-10-5-2)29(28-27-15)13-11-12(16(31)17(13)32)20(33)24-9-7-14(30)22-3/h12-13,16-17,31-32H,4-11H2,1-3H3,(H,22,30)(H,24,33)(H,23,25,26)/t12-,13+,16+,17-/m0/s1 |
| InChIKey | GXDHUWPTGRAROU-IXKJSCDLSA-N |
| XLogP | 0.47 |
| TPSA | 167.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|