C20H31F2N7O4S — CID 20690414
(1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-N-(2,2-difluoro-3-hydroxypropyl)-2,3-dihydroxycyclopentane-1-carboxamide (PubChem CID 20690414) has the molecular formula C20H31F2N7O4S and a molecular weight of 503.58 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-N-(2,2-difluoro-3-hydroxypropyl)-2,3-dihydroxycyclopentane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-N-(2,2-difluoro-3-hydroxypropyl)-2,3-dihydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 20690414 |
| Molecular Formula | C20H31F2N7O4S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-N-(2,2-difluoro-3-hydroxypropyl)-2,3-dihydroxycyclopentane-1-carboxamide |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2[C@@H]1C[C@H](C(=O)NCC(F)(F)CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H31F2N7O4S/c1-3-5-6-23-16-13-17(26-19(25-16)34-7-4-2)29(28-27-13)12-8-11(14(31)15(12)32)18(33)24-9-20(21,22)10-30/h11-12,14-15,30-32H,3-10H2,1-2H3,(H,24,33)(H,23,25,26)/t11-,12+,14+,15-/m0/s1 |
| InChIKey | GESLVAIULMWIQP-MXYBEHONSA-N |
| XLogP | 0.96 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|