C22H26N6O4S — CID 20690446
(1S,2R,3S,4R)-2,3-dihydroxy-4-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxylic acid (PubChem CID 20690446) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is (1S,2R,3S,4R)-2,3-dihydroxy-4-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2R,3S,4R)-2,3-dihydroxy-4-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 20690446 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (1S,2R,3S,4R)-2,3-dihydroxy-4-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxylic acid |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccccc2)c2nnn([C@@H]3C[C@H](C(=O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C22H26N6O4S/c1-2-8-33-22-24-19(23-14-9-12(14)11-6-4-3-5-7-11)16-20(25-22)28(27-26-16)15-10-13(21(31)32)17(29)18(15)30/h3-7,12-15,17-18,29-30H,2,8-10H2,1H3,(H,31,32)(H,23,24,25)/t12-,13-,14+,15+,17+,18-/m0/s1 |
| InChIKey | KERJWBKULGUMDV-SSDGSGIASA-N |
| XLogP | 2.06 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |