C22H26FN3O3 — CID 20691527
2-(3-fluorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid (PubChem CID 20691527) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid.
| Compound Name | 2-(3-fluorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 20691527 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-(3-fluorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
| SMILES | O=C(CCCCc1ccc2c(n1)NCCC2)NCC(C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FN3O3/c23-17-7-3-5-16(13-17)19(22(28)29)14-25-20(27)9-2-1-8-18-11-10-15-6-4-12-24-21(15)26-18/h3,5,7,10-11,13,19H,1-2,4,6,8-9,12,14H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | JAUBDECGBYELOG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|