C23H30N4O3 — CID 20691569
ethyl 3-pyridin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate (PubChem CID 20691569) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is ethyl 3-pyridin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate.
| Compound Name | ethyl 3-pyridin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 20691569 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | ethyl 3-pyridin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CCCCc1ccc2c(n1)NCCC2)c1cccnc1 |
| InChI | InChI=1S/C23H30N4O3/c1-2-30-22(29)15-20(18-8-5-13-24-16-18)27-21(28)10-4-3-9-19-12-11-17-7-6-14-25-23(17)26-19/h5,8,11-13,16,20H,2-4,6-7,9-10,14-15H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | WORXBKIMHPOAPD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|