C12H32O4Si4 — CID 20691840
2,6-diethyl-2,4,4,6,8-pentamethyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 20691840) has the molecular formula C12H32O4Si4 and a molecular weight of 352.73 g/mol. Its IUPAC name is 2,6-diethyl-2,4,4,6,8-pentamethyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,6-diethyl-2,4,4,6,8-pentamethyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 20691840 |
| Molecular Formula | C12H32O4Si4 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2,6-diethyl-2,4,4,6,8-pentamethyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C)O[Si](C)(CC)O[Si](C)(C)O[Si](C)(CC)O1 |
| InChI | InChI=1S/C12H32O4Si4/c1-9-12-20(8)15-18(6,10-2)13-17(4,5)14-19(7,11-3)16-20/h9-12H2,1-8H3 |
| InChIKey | NJQJSDRMQKIBBE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|