About 2-ethyl-5-methyl-1,2-dihydropyrazine
2-ethyl-5-methyl-1,2-dihydropyrazine (PubChem CID 20691937) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-ethyl-5-methyl-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-1,2-dihydropyrazine |
| PubChem CID | 20691937 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-ethyl-5-methyl-1,2-dihydropyrazine |
| SMILES | CCC1C=NC(C)=CN1 |
| InChI | InChI=1S/C7H12N2/c1-3-7-5-8-6(2)4-9-7/h4-5,7,9H,3H2,1-2H3 |
| InChIKey | PKVPFIVBLDKEAZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-methyl-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-1,2-dihydropyrazine?
The IUPAC name of 2-ethyl-5-methyl-1,2-dihydropyrazine (CID 20691937) is 2-ethyl-5-methyl-1,2-dihydropyrazine.
What is the SMILES notation for 2-ethyl-5-methyl-1,2-dihydropyrazine?
The canonical SMILES for 2-ethyl-5-methyl-1,2-dihydropyrazine is CCC1C=NC(C)=CN1.
What is the InChIKey of 2-ethyl-5-methyl-1,2-dihydropyrazine?
The InChIKey is PKVPFIVBLDKEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-7-5-8-6(2)4-9-7/h4-5,7,9H,3H2,1-2H3.
What are the key properties of 2-ethyl-5-methyl-1,2-dihydropyrazine?
2-ethyl-5-methyl-1,2-dihydropyrazine has a molecular weight of 124.19 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-1,2-dihydropyrazine is sourced from PubChem (CID 20691937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).