C17H19ClN2O — CID 20691980
N-[4-(2-chlorophenyl)-3-pyridinyl]-N,2,2-trimethylpropanamide (PubChem CID 20691980) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-3-pyridinyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[4-(2-chlorophenyl)-3-pyridinyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 20691980 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[4-(2-chlorophenyl)-3-pyridinyl]-N,2,2-trimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)C)c1cnccc1-c1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O/c1-17(2,3)16(21)20(4)15-11-19-10-9-13(15)12-7-5-6-8-14(12)18/h5-11H,1-4H3 |
| InChIKey | UFMVQHSMEZTZMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |