C14H28O2 — CID 20692066
1-(1,2-dimethoxyethyl)-1,3,3,5-tetramethylcyclohexane (PubChem CID 20692066) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-(1,2-dimethoxyethyl)-1,3,3,5-tetramethylcyclohexane.
| Compound Name | 1-(1,2-dimethoxyethyl)-1,3,3,5-tetramethylcyclohexane |
|---|---|
| PubChem CID | 20692066 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1-(1,2-dimethoxyethyl)-1,3,3,5-tetramethylcyclohexane |
| SMILES | COCC(OC)C1(C)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28O2/c1-11-7-13(2,3)10-14(4,8-11)12(16-6)9-15-5/h11-12H,7-10H2,1-6H3 |
| InChIKey | JUVJEUMGYLQPRY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |