About 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine
2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine (PubChem CID 20692082) has the molecular formula C10H17F2N
and a molecular weight of 189.25 g/mol. Its IUPAC name is 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine.
Molecular Properties
| Compound Name | 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine |
| PubChem CID | 20692082 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine |
| SMILES | CC1(C)CC(N)CC2(C1)CC2(F)F |
| InChI | InChI=1S/C10H17F2N/c1-8(2)3-7(13)4-9(5-8)6-10(9,11)12/h7H,3-6,13H2,1-2H3 |
| InChIKey | CKFGXSYUFADRPR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine?
The IUPAC name of 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine (CID 20692082) is 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine.
What is the SMILES notation for 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine?
The canonical SMILES for 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine is CC1(C)CC(N)CC2(C1)CC2(F)F.
What is the InChIKey of 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine?
The InChIKey is CKFGXSYUFADRPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N/c1-8(2)3-7(13)4-9(5-8)6-10(9,11)12/h7H,3-6,13H2,1-2H3.
What are the key properties of 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine?
2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine has a molecular weight of 189.25 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-7,7-dimethylspiro[2.5]octan-5-amine is sourced from PubChem (CID 20692082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).