C17H26O — CID 20692114
1-methoxy-4-(1,3,3,5-tetramethylcyclohexyl)benzene (PubChem CID 20692114) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-methoxy-4-(1,3,3,5-tetramethylcyclohexyl)benzene.
| Compound Name | 1-methoxy-4-(1,3,3,5-tetramethylcyclohexyl)benzene |
|---|---|
| PubChem CID | 20692114 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-methoxy-4-(1,3,3,5-tetramethylcyclohexyl)benzene |
| SMILES | COc1ccc(C2(C)CC(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H26O/c1-13-10-16(2,3)12-17(4,11-13)14-6-8-15(18-5)9-7-14/h6-9,13H,10-12H2,1-5H3 |
| InChIKey | GRSPWTWGYVQNII-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |